CAS 1261900-73-5

6-Fluoro-4′-hydroxy-3′-methoxy[1,1′-biphenyl]-3-carbonitrile

Description:

6-Fluoro-4′-hydroxy-3′-methoxy[1,1′-biphenyl]-3-carbonitrile, identified by its CAS number 1261900-73-5, is a chemical compound that belongs to the class of biphenyl derivatives. This substance features a biphenyl core with various functional groups, including a fluorine atom, a hydroxyl group, a methoxy group, and a cyano group. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity. The hydroxyl group can participate in hydrogen bonding, potentially affecting solubility and reactivity. The methoxy group often contributes to the compound's electronic properties, while the cyano group introduces a polar functional group that can engage in various chemical reactions. Overall, the combination of these functional groups suggests that this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific applications and behavior would depend on the context of its use, including potential interactions with biological targets.

Formula: C₁₄H₁₀FNO₂

InChI: InChI=1S/C14H10FNO2/c1-18-14-7-10(3-5-13(14)17)11-6-9(8-16)2-4-12(11)15/h2-7,17H,1H3

InChI key: InChIKey=FKCDJQNOJZTMTC-UHFFFAOYSA-N

SMILES: FC=1C(=CC(C#N)=CC1)C2=CC(OC)=C(O)C=C2

Synonyms:

• 6-Fluoro-4′-hydroxy-3′-methoxy[1,1′-biphenyl]-3-carbonitrile
• [1,1′-Biphenyl]-3-carbonitrile, 6-fluoro-4′-hydroxy-3′-methoxy-