CAS 1261900-90-6

2-Chloro-5-(5-hydroxy-2-pyridinyl)benzoic acid

Description:

2-Chloro-5-(5-hydroxy-2-pyridinyl)benzoic acid is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a chlorine atom and a pyridine derivative. The presence of the chloro group introduces electrophilic characteristics, while the hydroxyl group on the pyridine ring contributes to its potential as a hydrogen bond donor. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid and hydroxyl functionalities, while its aromatic nature may enhance its stability and interaction with other organic molecules. The compound may also possess biological activity, potentially acting as a ligand or inhibitor in various biochemical pathways, although specific biological properties would require empirical investigation. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds targeting specific biological processes. As with any chemical, handling should be conducted with appropriate safety measures, considering its potential reactivity and toxicity.

Formula: C₁₂H₈ClNO₃

InChI: InChI=1S/C12H8ClNO3/c13-10-3-1-7(5-9(10)12(16)17)11-4-2-8(15)6-14-11/h1-6,15H,(H,16,17)

InChI key: InChIKey=ROSBVPLETOXWFT-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=CC1Cl)C2=CC=C(O)C=N2

Synonyms:

• Benzoic acid, 2-chloro-5-(5-hydroxy-2-pyridinyl)-
• 2-Chloro-5-(5-hydroxy-2-pyridinyl)benzoic acid