CymitQuimica logo

CAS 1261901-20-5

:

2′,4′,6′-Trifluoro-4-methoxy[1,1′-biphenyl]-3-ol

Description:
2′,4′,6′-Trifluoro-4-methoxy[1,1′-biphenyl]-3-ol, identified by its CAS number 1261901-20-5, is a chemical compound characterized by its unique structural features, including a biphenyl backbone substituted with trifluoro and methoxy groups. The presence of three fluorine atoms at the 2′, 4′, and 6′ positions significantly influences its electronic properties, enhancing its lipophilicity and potentially affecting its reactivity and interaction with biological systems. The methoxy group at the 4′ position contributes to its overall polarity and can participate in hydrogen bonding. This compound is likely to exhibit interesting physicochemical properties, such as altered solubility and stability compared to its non-fluorinated counterparts. Additionally, the hydroxyl group at the 3 position may impart some degree of acidity, influencing its behavior in various chemical environments. Overall, the trifluoromethyl and methoxy substitutions suggest potential applications in pharmaceuticals, agrochemicals, or materials science, where such modifications can enhance efficacy or specificity.
Formula:C13H9F3O2
InChI:InChI=1S/C13H9F3O2/c1-18-12-3-2-7(4-11(12)17)13-9(15)5-8(14)6-10(13)16/h2-6,17H,1H3
InChI key:InChIKey=FDWZFUDUIISBMM-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC(O)=C(OC)C=C2)C(F)=CC(F)=C1
Synonyms:
  • [1,1′-Biphenyl]-3-ol, 2′,4′,6′-trifluoro-4-methoxy-
  • 2′,4′,6′-Trifluoro-4-methoxy[1,1′-biphenyl]-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.