CAS 1261901-22-7

2′-Formyl-3-nitro[1,1′-biphenyl]-4-carboxylic acid

Description:

2′-Formyl-3-nitro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a formyl group (-CHO) and a nitro group (-NO2) at specific positions on the biphenyl framework, along with a carboxylic acid group (-COOH). The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis and materials science. The nitro group is known for its electron-withdrawing properties, which can influence the compound's acidity and reactivity. Additionally, the carboxylic acid group can participate in various chemical reactions, including esterification and amidation. The compound's molecular structure suggests it may exhibit interesting properties such as solubility in polar solvents and potential biological activity. Its specific applications would depend on further studies, including its behavior in different chemical environments and its interactions with other substances.

Formula: C₁₄H₉NO₅

InChI: InChI=1S/C14H9NO5/c16-8-10-3-1-2-4-11(10)9-5-6-12(14(17)18)13(7-9)15(19)20/h1-8H,(H,17,18)

InChI key: InChIKey=INASVAUQOXMVLK-UHFFFAOYSA-N

SMILES: C(=O)C1=C(C2=CC(N(=O)=O)=C(C(O)=O)C=C2)C=CC=C1

Synonyms:

• 2′-Formyl-3-nitro[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 2′-formyl-3-nitro-