CAS 1261901-41-0

4′-Chloro-5-hydroxy-2′-methoxy[1,1′-biphenyl]-3-carbonitrile

Description:

4′-Chloro-5-hydroxy-2′-methoxy[1,1′-biphenyl]-3-carbonitrile is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the para position, a hydroxy group at the meta position, and a methoxy group at the ortho position on one of the phenyl rings contributes to its unique chemical properties. Additionally, the carbonitrile functional group at the 3-position introduces a polar and reactive site, enhancing its potential for various chemical reactions. This compound may exhibit biological activity due to its structural features, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can be influenced by the substituents on the biphenyl framework, which can affect its interactions in biological systems or chemical environments. Overall, the compound's characteristics make it a subject of interest in organic synthesis and medicinal chemistry.

Formula: C₁₄H₁₀ClNO₂

InChI: InChI=1S/C14H10ClNO2/c1-18-14-7-11(15)2-3-13(14)10-4-9(8-16)5-12(17)6-10/h2-7,17H,1H3

InChI key: InChIKey=DAQQBJKLVJZZQF-UHFFFAOYSA-N

SMILES: O(C)C1=C(C2=CC(C#N)=CC(O)=C2)C=CC(Cl)=C1

Synonyms:

• 4′-Chloro-5-hydroxy-2′-methoxy[1,1′-biphenyl]-3-carbonitrile
• [1,1′-Biphenyl]-3-carbonitrile, 4′-chloro-5-hydroxy-2′-methoxy-