
CAS 1261901-50-1
:4-(4-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone
Description:
4-(4-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone, identified by its CAS number 1261901-50-1, is a chemical compound characterized by its unique structural features, which include a pyridinone core and a substituted phenyl group. The presence of a fluorine atom and a methoxy group on the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound may exhibit properties such as moderate to high lipophilicity due to the aromatic systems, which can influence its solubility and permeability in biological systems. Additionally, the pyridinone moiety may participate in hydrogen bonding and coordination with metal ions, making it of interest in medicinal chemistry and drug design. Its specific interactions and effects would depend on the context of its use, including potential applications in pharmaceuticals or as a research tool in various biochemical assays. Overall, the compound's unique functional groups and structural characteristics suggest it may have significant implications in chemical and biological research.
Formula:C12H10FNO2
InChI:InChI=1S/C12H10FNO2/c1-16-11-6-8(2-3-10(11)13)9-4-5-14-12(15)7-9/h2-7H,1H3,(H,14,15)
InChI key:InChIKey=WVWJTHIWEWPETL-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1F)C2=CC(=O)NC=C2
Synonyms:- 4-(4-Fluoro-3-methoxyphenyl)-2(1H)-pyridinone
- 2(1H)-Pyridinone, 4-(4-fluoro-3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.