CymitQuimica logo

CAS 1261901-84-1

:

5-Fluoro-3′-(hydroxymethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:
5-Fluoro-3′-(hydroxymethyl)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The hydroxymethyl group (-CH2OH) adds a polar functional group that can participate in hydrogen bonding, enhancing the compound's solubility in polar solvents. The fluorine atom introduces electronegativity, which can influence the compound's reactivity and biological activity. This compound may exhibit interesting properties in medicinal chemistry, particularly in drug design, due to its structural features that can interact with biological targets. Additionally, its unique combination of functional groups may contribute to its potential applications in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, its stability, reactivity, and interactions depend on environmental conditions such as pH and temperature.
Formula:C14H11FO3
InChI:InChI=1S/C14H11FO3/c15-13-6-11(5-12(7-13)14(17)18)10-3-1-2-9(4-10)8-16/h1-7,16H,8H2,(H,17,18)
InChI key:InChIKey=VVQGOXCFXWQRDB-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(F)C1)C2=CC(CO)=CC=C2
Synonyms:
  • 5-Fluoro-3′-(hydroxymethyl)[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 5-fluoro-3′-(hydroxymethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.