CAS 1261902-06-0

4′-Cyano-4-methyl[1,1′-biphenyl]-2-carboxylic acid

Description:

4′-Cyano-4-methyl[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) and a carboxylic acid group (-COOH) contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the biphenyl moiety. Its functional groups can participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties such as melting point and boiling point. The compound may also exhibit interesting optical properties, making it a candidate for use in liquid crystal displays or as a dye. Additionally, the presence of the cyano group can enhance its electron-withdrawing characteristics, potentially affecting its reactivity in chemical reactions. Overall, 4′-Cyano-4-methyl[1,1′-biphenyl]-2-carboxylic acid is a versatile compound with various potential applications in synthetic chemistry and materials development.

Formula: C₁₅H₁₁NO₂

InChI: InChI=1S/C15H11NO2/c1-10-2-7-13(14(8-10)15(17)18)12-5-3-11(9-16)4-6-12/h2-8H,1H3,(H,17,18)

InChI key: InChIKey=UJKFAHDGKYFKDG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC(C)=C1)C2=CC=C(C#N)C=C2

Synonyms:

• [1,1′-Biphenyl]-2-carboxylic acid, 4′-cyano-4-methyl-
• 4′-Cyano-4-methyl[1,1′-biphenyl]-2-carboxylic acid