CAS 1261902-13-9

2′-Hydroxy[1,1′-biphenyl]-2,3′-dicarboxaldehyde

Description:

2′-Hydroxy[1,1′-biphenyl]-2,3′-dicarboxaldehyde, identified by its CAS number 1261902-13-9, is an organic compound characterized by the presence of two aldehyde functional groups and a hydroxyl group attached to a biphenyl structure. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, with hydroxyl and aldehyde substituents that contribute to its reactivity and potential applications in organic synthesis. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its hydrogen bonding capabilities. The aldehyde groups can participate in various chemical reactions, including condensation and oxidation, making this compound valuable in synthetic organic chemistry. Additionally, its structural features may impart specific optical or electronic properties, which could be explored in materials science or as intermediates in the synthesis of more complex molecules. Overall, 2′-Hydroxy[1,1′-biphenyl]-2,3′-dicarboxaldehyde is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₄H₁₀O₃

InChI: InChI=1S/C14H10O3/c15-8-10-4-1-2-6-12(10)13-7-3-5-11(9-16)14(13)17/h1-9,17H

InChI key: InChIKey=JELFZCDBAALMDO-UHFFFAOYSA-N

SMILES: C(=O)C1=C(C=CC=C1)C2=C(O)C(C=O)=CC=C2

Synonyms:

• 2′-Hydroxy[1,1′-biphenyl]-2,3′-dicarboxaldehyde
• [1,1′-Biphenyl]-2,3′-dicarboxaldehyde, 2′-hydroxy-