
CAS 1261902-21-9
:2-Hydroxy-2′,5′-dimethyl[1,1′-biphenyl]-3-carboxaldehyde
Description:
2-Hydroxy-2′,5′-dimethyl[1,1′-biphenyl]-3-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and an aldehyde group (-CHO) attached to the biphenyl framework, contributing to its reactivity and potential applications in organic synthesis. The presence of two methyl groups at the 2 and 5 positions of the biphenyl enhances its hydrophobic character and may influence its solubility in various solvents. The hydroxyl group can participate in hydrogen bonding, affecting its physical properties such as boiling point and melting point. Additionally, the aldehyde functionality allows for further chemical transformations, making it a valuable intermediate in the synthesis of more complex organic molecules. Its unique structure and functional groups may also impart specific biological activities, warranting investigation in fields such as medicinal chemistry. Overall, this compound exemplifies the diverse chemistry associated with substituted biphenyl derivatives.
Formula:C15H14O2
InChI:InChI=1S/C15H14O2/c1-10-6-7-11(2)14(8-10)13-5-3-4-12(9-16)15(13)17/h3-9,17H,1-2H3
InChI key:InChIKey=UNGTVCSVCFVEBH-UHFFFAOYSA-N
SMILES:OC1=C(C=CC=C1C=O)C2=C(C)C=CC(C)=C2
Synonyms:- [1,1′-Biphenyl]-3-carboxaldehyde, 2-hydroxy-2′,5′-dimethyl-
- 2-Hydroxy-2′,5′-dimethyl[1,1′-biphenyl]-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.