
CAS 1261902-46-8
:5-Chloro-4′-ethoxy-2′-methyl[1,1′-biphenyl]-3-ol
Description:
5-Chloro-4′-ethoxy-2′-methyl[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) at the 3-position, contributing to its classification as a phenolic compound. The presence of a chlorine atom at the 5-position and an ethoxy group (-OCH2CH3) at the 4′-position, along with a methyl group (-CH3) at the 2′-position, indicates a complex substitution pattern that can influence its chemical reactivity and physical properties. Typically, such compounds exhibit moderate solubility in organic solvents and may show varying degrees of polarity due to the functional groups present. The presence of the hydroxyl group suggests potential for hydrogen bonding, which can affect boiling and melting points. Additionally, the chlorine substituent may impart unique electronic properties, influencing the compound's reactivity in various chemical reactions. Overall, the structural features of this compound suggest potential applications in pharmaceuticals or agrochemicals, though specific uses would depend on further research and development.
Formula:C15H15ClO2
InChI:InChI=1S/C15H15ClO2/c1-3-18-14-4-5-15(10(2)6-14)11-7-12(16)9-13(17)8-11/h4-9,17H,3H2,1-2H3
InChI key:InChIKey=VORSRXJQRBDRKU-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC(Cl)=CC(O)=C2)C=CC(OCC)=C1
Synonyms:- [1,1′-Biphenyl]-3-ol, 5-chloro-4′-ethoxy-2′-methyl-
- 5-Chloro-4′-ethoxy-2′-methyl[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.