CymitQuimica logo

CAS 1261902-57-1

:

2′-Fluoro-3-hydroxy-5′-methyl[1,1′-biphenyl]-4-carboxaldehyde

Description:
2′-Fluoro-3-hydroxy-5′-methyl[1,1′-biphenyl]-4-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 2′ position and a hydroxyl group at the 3 position contributes to its unique chemical properties, influencing its reactivity and potential applications in various fields, including pharmaceuticals and materials science. The 5′-methyl group adds to the compound's steric and electronic characteristics, while the aldehyde functional group at the 4 position makes it a versatile intermediate for further chemical transformations. This compound may exhibit specific solubility characteristics, depending on the solvent, and its functional groups can participate in hydrogen bonding, affecting its physical properties. Additionally, the presence of the fluorine atom may enhance its lipophilicity and alter its biological activity. Overall, this compound's structural features suggest potential utility in synthetic organic chemistry and medicinal chemistry.
Formula:C14H11FO2
InChI:InChI=1S/C14H11FO2/c1-9-2-5-13(15)12(6-9)10-3-4-11(8-16)14(17)7-10/h2-8,17H,1H3
InChI key:InChIKey=WALBYYMDFFSFRB-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC(O)=C(C=O)C=C2)C=C(C)C=C1
Synonyms:
  • 2′-Fluoro-3-hydroxy-5′-methyl[1,1′-biphenyl]-4-carboxaldehyde
  • [1,1′-Biphenyl]-4-carboxaldehyde, 2′-fluoro-3-hydroxy-5′-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.