CAS 1261902-77-5

4′-Methoxy-2′-methyl-3-nitro[1,1′-biphenyl]-4-ol

Description:

4′-Methoxy-2′-methyl-3-nitro[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) at the 2' position, a nitro group (-NO2) at the 3 position, and a hydroxyl group (-OH) at the 4 position of one of the phenyl rings. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The nitro group is known for its electron-withdrawing properties, which can influence the compound's acidity and reactivity. Additionally, the methoxy group can enhance solubility in organic solvents. The compound's molecular structure suggests it may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₄H₁₃NO₄

InChI: InChI=1S/C14H13NO4/c1-9-7-11(19-2)4-5-12(9)10-3-6-14(16)13(8-10)15(17)18/h3-8,16H,1-2H3

InChI key: InChIKey=YTGSPKGPBOOVDR-UHFFFAOYSA-N

SMILES: CC1=C(C=CC(OC)=C1)C2=CC(N(=O)=O)=C(O)C=C2

Synonyms:

• [1,1′-Biphenyl]-4-ol, 4′-methoxy-2′-methyl-3-nitro-
• 4′-Methoxy-2′-methyl-3-nitro[1,1′-biphenyl]-4-ol