
CAS 1261902-88-8
:2′-Fluoro-5′-methyl-3-nitro[1,1′-biphenyl]-4-carboxylic acid
Description:
2′-Fluoro-5′-methyl-3-nitro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The compound features a nitro group (-NO2) and a fluoro group (-F) attached to the biphenyl framework, which can influence its reactivity and polarity. The methyl group (-CH3) adds to the hydrophobic character of the molecule. The specific arrangement of these substituents contributes to the compound's overall chemical properties, including its solubility, melting point, and potential biological activity. Additionally, the presence of halogen and nitro groups often enhances the compound's reactivity, making it of interest in various chemical syntheses and applications in pharmaceuticals or agrochemicals. As with many organic compounds, its behavior in different solvents and under various conditions can vary significantly.
Formula:C14H10FNO4
InChI:InChI=1S/C14H10FNO4/c1-8-2-5-12(15)11(6-8)9-3-4-10(14(17)18)13(7-9)16(19)20/h2-7H,1H3,(H,17,18)
InChI key:InChIKey=XKDLSHURBVREJM-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC(N(=O)=O)=C(C(O)=O)C=C2)C=C(C)C=C1
Synonyms:- 2′-Fluoro-5′-methyl-3-nitro[1,1′-biphenyl]-4-carboxylic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 2′-fluoro-5′-methyl-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.