CymitQuimica logo

CAS 1261902-92-4

:

5-Bromo-3′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-3-ol

Description:
5-Bromo-3′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-3-ol is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a bromine atom and a sulfonyl group linked to a pyrrolidine moiety. This compound features a hydroxyl group (-OH) at the 3-position of the biphenyl, contributing to its potential as a phenolic compound. The presence of the bromine atom enhances its reactivity and may influence its biological activity. The pyrrolidinylsulfonyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for various synthetic applications. Additionally, its unique structure may confer specific properties, such as antimicrobial or anti-inflammatory activities, warranting further investigation in drug discovery and development. As with many chemical substances, safety and handling precautions should be observed due to potential hazards associated with its components.
Formula:C16H16BrNO3S
InChI:InChI=1S/C16H16BrNO3S/c17-14-8-13(9-15(19)11-14)12-4-3-5-16(10-12)22(20,21)18-6-1-2-7-18/h3-5,8-11,19H,1-2,6-7H2
InChI key:InChIKey=WQFOXKLMXAUZTC-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C=1C=C(C=CC1)C2=CC(Br)=CC(O)=C2)N3CCCC3
Synonyms:
  • 5-Bromo-3′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-3-ol
  • [1,1′-Biphenyl]-3-ol, 5-bromo-3′-(1-pyrrolidinylsulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.