
CAS 1261902-94-6
:3′-Fluoro-3-hydroxy-2′-methyl[1,1′-biphenyl]-4-carboxylic acid
Description:
3′-Fluoro-3-hydroxy-2′-methyl[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3′ position and a hydroxy group at the same position contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The 2′-methyl group adds to the steric bulk and may influence the compound's interactions with biological systems or other chemical entities. The carboxylic acid functional group at the 4-position provides acidic properties, allowing for potential hydrogen bonding and interactions with other molecules. This compound may exhibit interesting pharmacological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Its CAS number, 1261902-94-6, allows for easy identification and retrieval of information related to its synthesis, applications, and safety data in chemical databases.
Formula:C14H11FO3
InChI:InChI=1S/C14H11FO3/c1-8-10(3-2-4-12(8)15)9-5-6-11(14(17)18)13(16)7-9/h2-7,16H,1H3,(H,17,18)
InChI key:InChIKey=SHFPBRLDNNGWLH-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1F)C2=CC(O)=C(C(O)=O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-carboxylic acid, 3′-fluoro-3-hydroxy-2′-methyl-
- 3′-Fluoro-3-hydroxy-2′-methyl[1,1′-biphenyl]-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.