CAS 1261903-04-1

3-(2-Thienyl)-4-pyridinecarboxylic acid

Description:

3-(2-Thienyl)-4-pyridinecarboxylic acid is an organic compound characterized by its heterocyclic structure, which includes both a pyridine and a thiophene ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the thiophene ring imparts unique electronic and steric characteristics, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure allows for potential interactions through hydrogen bonding, which can influence its reactivity and stability. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Overall, 3-(2-Thienyl)-4-pyridinecarboxylic acid is notable for its unique structural features and potential applications in various fields of chemistry.

Formula: C₁₀H₇NO₂S

InChI: InChI=1S/C10H7NO2S/c12-10(13)7-3-4-11-6-8(7)9-2-1-5-14-9/h1-6H,(H,12,13)

InChI key: InChIKey=DJHQZVCWHSIWLD-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CN=CC1)C2=CC=CS2

Synonyms:

• 3-(2-Thienyl)-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 3-(2-thienyl)-