CAS 1261903-31-4

3′-Fluoro-5′-hydroxy-2-methyl[1,1′-biphenyl]-4-carboxylic acid

Description:

3′-Fluoro-5′-hydroxy-2-methyl[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3′ position and a hydroxy group at the 5′ position contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The carboxylic acid functional group at the 4-position indicates that the compound can participate in acid-base reactions and may exhibit acidic behavior in solution. The methyl group at the 2-position adds to the compound's steric and electronic properties, influencing its overall reactivity and interaction with other molecules. This compound may have applications in pharmaceuticals or materials science, particularly in the development of compounds with specific biological activities or as intermediates in synthetic pathways. Its specific characteristics, such as melting point, boiling point, and solubility, would require empirical measurement or literature reference for detailed analysis.

Formula: C₁₄H₁₁FO₃

InChI: InChI=1S/C14H11FO3/c1-8-4-9(14(17)18)2-3-13(8)10-5-11(15)7-12(16)6-10/h2-7,16H,1H3,(H,17,18)

InChI key: InChIKey=WODQYYICTSIIFL-UHFFFAOYSA-N

SMILES: CC1=C(C=CC(C(O)=O)=C1)C2=CC(F)=CC(O)=C2

Synonyms:

• 3′-Fluoro-5′-hydroxy-2-methyl[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 3′-fluoro-5′-hydroxy-2-methyl-