
CAS 1261903-40-5
:2′-(Methylthio)-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol
Description:
2′-(Methylthio)-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3-position contributes to its potential as a phenolic compound, which may exhibit antioxidant properties. The methylthio group (-S-CH3) at the 2′ position introduces a sulfur atom, which can influence the compound's reactivity and solubility. Additionally, the trifluoromethoxy group (-O-CF3) at the 5-position enhances the compound's lipophilicity and may affect its electronic properties, making it of interest in medicinal chemistry and material science. The trifluoromethyl moiety is known for its ability to modulate biological activity and improve pharmacokinetic profiles. Overall, this compound's unique functional groups suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific biological or chemical activities would require further investigation.
Formula:C14H11F3O2S
InChI:InChI=1S/C14H11F3O2S/c1-20-13-5-3-2-4-12(13)9-6-10(18)8-11(7-9)19-14(15,16)17/h2-8,18H,1H3
InChI key:InChIKey=XHTSIXRUEKRZIN-UHFFFAOYSA-N
SMILES:S(C)C1=C(C=CC=C1)C2=CC(OC(F)(F)F)=CC(O)=C2
Synonyms:- 2′-(Methylthio)-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 2′-(methylthio)-5-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.