
CAS 1261903-91-6
:2-Methoxy-4′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid
Description:
2-Methoxy-4′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a biphenyl core, a methoxy group, a pyrrolidinylsulfonyl moiety, and a carboxylic acid functional group. This compound is typically classified as an organic sulfonamide, which may exhibit various biological activities due to the presence of the pyrrolidine ring and the sulfonyl group. The methoxy group can influence the compound's solubility and reactivity, while the carboxylic acid group contributes to its acidity and potential interactions in biological systems. The presence of multiple functional groups suggests that this compound may participate in hydrogen bonding and other intermolecular interactions, which can affect its pharmacokinetic properties. Additionally, the biphenyl structure may enhance its stability and lipophilicity, making it a candidate for further investigation in medicinal chemistry. Overall, the unique combination of functional groups in this compound may lead to diverse applications in pharmaceuticals or agrochemicals.
Formula:C18H19NO5S
InChI:InChI=1S/C18H19NO5S/c1-24-17-15(5-4-6-16(17)18(20)21)13-7-9-14(10-8-13)25(22,23)19-11-2-3-12-19/h4-10H,2-3,11-12H2,1H3,(H,20,21)
InChI key:InChIKey=DZTJXMMGWCDSLP-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1C(O)=O)C2=CC=C(S(=O)(=O)N3CCCC3)C=C2
Synonyms:- 2-Methoxy-4′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 2-methoxy-4′-(1-pyrrolidinylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.