CAS 1261904-52-2

3′-(Aminocarbonyl)-5-nitro[1,1′-biphenyl]-3-carboxylic acid

Description:

3′-(Aminocarbonyl)-5-nitro[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features multiple functional groups, including an aminocarbonyl group (–CONH2), a nitro group (–NO2), and a carboxylic acid group (–COOH), contributing to its potential reactivity and solubility properties. The presence of the nitro group typically imparts electron-withdrawing characteristics, influencing the compound's acidity and reactivity in various chemical reactions. The carboxylic acid group can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural complexity suggests potential applications in organic synthesis and materials science. As with many organic compounds, safety and handling precautions should be observed due to the presence of reactive functional groups. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₄H₁₀N₂O₅

InChI: InChI=1S/C14H10N2O5/c15-13(17)9-3-1-2-8(4-9)10-5-11(14(18)19)7-12(6-10)16(20)21/h1-7H,(H2,15,17)(H,18,19)

InChI key: InChIKey=KHUKKECCVDLZCO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(N(=O)=O)C1)C2=CC(C(N)=O)=CC=C2

Synonyms:

• 3′-(Aminocarbonyl)-5-nitro[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 3′-(aminocarbonyl)-5-nitro-