CymitQuimica logo

CAS 1261904-63-5

:

3-(3-Fluoro-4-methylphenyl)-4-pyridinecarboxylic acid

Description:
3-(3-Fluoro-4-methylphenyl)-4-pyridinecarboxylic acid is an organic compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a fluorine atom and a methyl group on the phenyl ring contributes to its unique chemical properties, such as potential variations in polarity and reactivity. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic components may enhance its stability and hydrophobic interactions. It may also participate in hydrogen bonding due to the carboxylic acid functionality. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where modifications to aromatic systems can influence biological activity. Additionally, the presence of the fluorine atom may enhance metabolic stability or alter the lipophilicity of the compound, making it of interest in drug design. Overall, 3-(3-Fluoro-4-methylphenyl)-4-pyridinecarboxylic acid is a versatile compound with potential implications in various chemical and biological fields.
Formula:C13H10FNO2
InChI:InChI=1S/C13H10FNO2/c1-8-2-3-9(6-12(8)14)11-7-15-5-4-10(11)13(16)17/h2-7H,1H3,(H,16,17)
InChI key:InChIKey=HSQCSIKKJUAOFP-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CN=CC1)C2=CC(F)=C(C)C=C2
Synonyms:
  • 3-(3-Fluoro-4-methylphenyl)-4-pyridinecarboxylic acid
  • 4-Pyridinecarboxylic acid, 3-(3-fluoro-4-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.