CymitQuimica logo

CAS 1261905-29-6

:

5-(4-Chlorophenyl)-2-methoxy-3-pyridinecarboxylic acid

Description:
5-(4-Chlorophenyl)-2-methoxy-3-pyridinecarboxylic acid is an organic compound characterized by its complex structure, which includes a pyridine ring substituted with a methoxy group and a carboxylic acid functional group. The presence of the 4-chlorophenyl group contributes to its aromatic properties and may influence its reactivity and interactions with biological systems. This compound is likely to exhibit moderate solubility in organic solvents due to its polar functional groups, while its carboxylic acid moiety can participate in hydrogen bonding, affecting its solubility in water. The chlorophenyl substituent may also impart specific electronic properties, potentially enhancing its biological activity or reactivity in chemical reactions. As a pyridine derivative, it may exhibit basic characteristics, allowing it to act as a ligand in coordination chemistry. Overall, the unique combination of functional groups in this compound suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C13H10ClNO3
InChI:InChI=1S/C13H10ClNO3/c1-18-12-11(13(16)17)6-9(7-15-12)8-2-4-10(14)5-3-8/h2-7H,1H3,(H,16,17)
InChI key:InChIKey=GVHRUORYEHOBET-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1OC)C2=CC=C(Cl)C=C2
Synonyms:
  • 5-(4-Chlorophenyl)-2-methoxy-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 5-(4-chlorophenyl)-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.