CAS 1261905-55-8

2-Amino-5-(3-carboxyphenyl)-3-pyridinecarboxylic acid

Description:

2-Amino-5-(3-carboxyphenyl)-3-pyridinecarboxylic acid, also known by its CAS number 1261905-55-8, is an organic compound characterized by its complex structure that includes both amino and carboxylic acid functional groups. This compound features a pyridine ring, which contributes to its aromatic properties, and a phenyl group with a carboxylic acid substituent, enhancing its potential for hydrogen bonding and solubility in polar solvents. The presence of multiple functional groups suggests that it may exhibit both acidic and basic properties, making it a zwitterionic species under certain conditions. Its molecular structure allows for potential applications in pharmaceuticals, particularly in drug design, due to its ability to interact with biological targets. Additionally, the compound may participate in various chemical reactions, including esterification and amidation, which could be useful in synthetic organic chemistry. Overall, 2-Amino-5-(3-carboxyphenyl)-3-pyridinecarboxylic acid is a versatile compound with significant implications in medicinal chemistry and related fields.

Formula: C₁₃H₁₀N₂O₄

InChI: InChI=1S/C13H10N2O4/c14-11-10(13(18)19)5-9(6-15-11)7-2-1-3-8(4-7)12(16)17/h1-6H,(H2,14,15)(H,16,17)(H,18,19)

InChI key: InChIKey=XDTXYMFNIGFKBO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CN=C1N)C2=CC(C(O)=O)=CC=C2

Synonyms:

• 2-Amino-5-(3-carboxyphenyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 2-amino-5-(3-carboxyphenyl)-