CAS 1261905-96-7

6-(3-Ethoxyphenyl)-2-pyridinecarboxylic acid

Description:

6-(3-Ethoxyphenyl)-2-pyridinecarboxylic acid is an organic compound characterized by its pyridine and carboxylic acid functional groups, which contribute to its chemical reactivity and potential biological activity. The presence of the ethoxyphenyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. This compound may exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can affect its behavior in various chemical environments. Additionally, the pyridine ring can participate in coordination with metal ions, making it of interest in coordination chemistry. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where such functional groups are often associated with bioactivity. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and could provide insights into its stability and reactivity. Overall, 6-(3-Ethoxyphenyl)-2-pyridinecarboxylic acid represents a versatile structure with potential applications in various fields of chemistry.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1S/C14H13NO3/c1-2-18-11-6-3-5-10(9-11)12-7-4-8-13(15-12)14(16)17/h3-9H,2H2,1H3,(H,16,17)

InChI key: InChIKey=XCMBAZJTKKGFAO-UHFFFAOYSA-N

SMILES: O(CC)C=1C=C(C=CC1)C=2N=C(C(O)=O)C=CC2

Synonyms:

• 2-Pyridinecarboxylic acid, 6-(3-ethoxyphenyl)-
• 6-(3-Ethoxyphenyl)-2-pyridinecarboxylic acid