CymitQuimica logo

CAS 1261906-10-8

:

5-Bromo-1-butyl-6-fluoro-1H-benzimidazole

Description:
5-Bromo-1-butyl-6-fluoro-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a bromine atom at the 5-position and a fluorine atom at the 6-position, along with a butyl group at the 1-position. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of halogen substituents (bromine and fluorine) can influence its reactivity, making it potentially useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the butyl group contributes to its hydrophobic character, which may affect its biological activity and interactions with other molecules. Compounds of this type are often studied for their potential applications in pharmaceuticals, agrochemicals, or materials science due to their diverse functional properties. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C11H12BrFN2
InChI:InChI=1S/C11H12BrFN2/c1-2-3-4-15-7-14-10-5-8(12)9(13)6-11(10)15/h5-7H,2-4H2,1H3
InChI key:InChIKey=FOMBBMGIYHOYON-UHFFFAOYSA-N
SMILES:C(CCC)N1C=2C(=CC(Br)=C(F)C2)N=C1
Synonyms:
  • 5-Bromo-1-butyl-6-fluoro-1H-benzimidazole
  • 1H-Benzimidazole, 5-bromo-1-butyl-6-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.