CymitQuimica logo

CAS 1261906-11-9

:

2-[4-(Methylthio)phenyl]-4-pyridinecarboxylic acid

Description:
2-[4-(Methylthio)phenyl]-4-pyridinecarboxylic acid, identified by its CAS number 1261906-11-9, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a methylthio group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methylthio group can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interactions in biological systems. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Its unique structure may confer specific biological activities, making it of interest in pharmaceutical research. Overall, the compound's characteristics, including solubility, melting point, and reactivity, would depend on its molecular interactions and the environment in which it is studied.
Formula:C13H11NO2S
InChI:InChI=1S/C13H11NO2S/c1-17-11-4-2-9(3-5-11)12-8-10(13(15)16)6-7-14-12/h2-8H,1H3,(H,15,16)
InChI key:InChIKey=YQHYDJWUCRULAV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(N=CC1)C2=CC=C(SC)C=C2
Synonyms:
  • 4-Pyridinecarboxylic acid, 2-[4-(methylthio)phenyl]-
  • 2-[4-(Methylthio)phenyl]-4-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.