
CAS 1261906-30-2
:5-[3-(Aminocarbonyl)-4-chlorophenyl]-3-pyridinecarboxylic acid
Description:
5-[3-(Aminocarbonyl)-4-chlorophenyl]-3-pyridinecarboxylic acid, with the CAS number 1261906-30-2, is a chemical compound characterized by its complex molecular structure, which includes a pyridine ring and a chlorophenyl group. This compound features an aminocarbonyl functional group, contributing to its potential as a bioactive molecule. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of carboxylic acid and amine functionalities. The chlorophenyl moiety can influence its electronic properties and reactivity, making it of interest in medicinal chemistry and drug development. The presence of both acidic and basic functional groups suggests that it may participate in various chemical reactions, including hydrogen bonding and potential interactions with biological targets. Its specific applications and behavior in biological systems would depend on further studies, including its pharmacokinetics and pharmacodynamics. Overall, this compound represents a class of molecules that may have significant implications in pharmaceutical research.
Formula:C13H9ClN2O3
InChI:InChI=1S/C13H9ClN2O3/c14-11-2-1-7(4-10(11)12(15)17)8-3-9(13(18)19)6-16-5-8/h1-6H,(H2,15,17)(H,18,19)
InChI key:InChIKey=PPFCVPNJLPHJOT-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C=C(C=CC1Cl)C=2C=C(C(O)=O)C=NC2
Synonyms:- 3-Pyridinecarboxylic acid, 5-[3-(aminocarbonyl)-4-chlorophenyl]-
- 5-[3-(Aminocarbonyl)-4-chlorophenyl]-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.