CAS 1261906-43-7

4′-Acetyl-4-methoxy[1,1′-biphenyl]-2-carboxylic acid

Description:

4′-Acetyl-4-methoxy[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an acetyl group and a methoxy group, contributing to its chemical reactivity and solubility properties. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may form salts or esters. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The compound's specific physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Additionally, its CAS number, 1261906-43-7, allows for precise identification in chemical databases, facilitating research and development in various fields. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical applications.

Formula: C₁₆H₁₄O₄

InChI: InChI=1S/C16H14O4/c1-10(17)11-3-5-12(6-4-11)14-8-7-13(20-2)9-15(14)16(18)19/h3-9H,1-2H3,(H,18,19)

InChI key: InChIKey=DKQPCNKAHZHNFP-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC(OC)=C1)C2=CC=C(C(C)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-2-carboxylic acid, 4′-acetyl-4-methoxy-
• 4′-Acetyl-4-methoxy[1,1′-biphenyl]-2-carboxylic acid