CAS 1261907-63-4

N-(4′-Formyl-3′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide

Description:

N-(4′-Formyl-3′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide is a chemical compound characterized by its unique structure, which includes a biphenyl moiety with a formyl group and a hydroxy group at specific positions. The presence of the methanesulfonamide functional group contributes to its potential as a sulfonamide derivative, which may exhibit various biological activities. This compound is likely to be a solid at room temperature, with solubility influenced by the functional groups present, particularly the polar sulfonamide and hydroxy groups. Its molecular structure suggests potential applications in medicinal chemistry, possibly as an intermediate in the synthesis of pharmaceuticals or as a ligand in coordination chemistry. The compound's reactivity may be influenced by the aldehyde group, which can participate in condensation reactions, while the sulfonamide group may enhance its interaction with biological targets. Overall, this compound represents a class of organic molecules that could be of interest in both synthetic and applied chemistry contexts.

Formula: C₁₄H₁₃NO₄S

InChI: InChI=1S/C14H13NO4S/c1-20(18,19)15-13-4-2-3-10(7-13)11-5-6-12(9-16)14(17)8-11/h2-9,15,17H,1H3

InChI key: InChIKey=BZDIWHSHQLGXGU-UHFFFAOYSA-N

SMILES: OC=1C=C(C=CC1C=O)C2=CC(NS(C)(=O)=O)=CC=C2

Synonyms:

• Methanesulfonamide, N-(4′-formyl-3′-hydroxy[1,1′-biphenyl]-3-yl)-
• N-(4′-Formyl-3′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide