CymitQuimica logo

CAS 1261907-72-5

:

3-Hydroxy-2′-(methylthio)[1,1′-biphenyl]-4-carboxylic acid

Description:
3-Hydroxy-2′-(methylthio)[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3-position and a carboxylic acid group (-COOH) at the 4-position contributes to its acidic properties and potential for hydrogen bonding. The methylthio group (-S-CH3) at the 2′ position enhances its lipophilicity and may influence its reactivity and solubility in organic solvents. This compound may exhibit biological activity due to its structural features, making it of interest in pharmaceutical and agrochemical research. Its molecular interactions can be influenced by the functional groups present, which may affect its behavior in various chemical environments. Overall, 3-Hydroxy-2′-(methylthio)[1,1′-biphenyl]-4-carboxylic acid represents a complex organic molecule with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C14H12O3S
InChI:InChI=1S/C14H12O3S/c1-18-13-5-3-2-4-10(13)9-6-7-11(14(16)17)12(15)8-9/h2-8,15H,1H3,(H,16,17)
InChI key:InChIKey=CQNJWPKHUIIWQF-UHFFFAOYSA-N
SMILES:S(C)C1=C(C2=CC(O)=C(C(O)=O)C=C2)C=CC=C1
Synonyms:
  • 3-Hydroxy-2′-(methylthio)[1,1′-biphenyl]-4-carboxylic acid
  • [1,1′-Biphenyl]-4-carboxylic acid, 3-hydroxy-2′-(methylthio)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.