
CAS 1261908-12-6
:3-(1,2-Dihydro-2-oxo-4-pyridinyl)-2-fluorobenzonitrile
Description:
3-(1,2-Dihydro-2-oxo-4-pyridinyl)-2-fluorobenzonitrile, with the CAS number 1261908-12-6, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a fluorobenzonitrile moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The fluorine atom in the benzonitrile portion can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. The presence of the 1,2-dihydro-2-oxo-pyridine structure may contribute to its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the specific environment in which it is studied. Overall, this compound may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its biological and chemical behavior.
Formula:C12H7FN2O
InChI:InChI=1S/C12H7FN2O/c13-12-9(7-14)2-1-3-10(12)8-4-5-15-11(16)6-8/h1-6H,(H,15,16)
InChI key:InChIKey=JJYDHQSEQVBHST-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1C#N)C2=CC(=O)NC=C2
Synonyms:- Benzonitrile, 3-(1,2-dihydro-2-oxo-4-pyridinyl)-2-fluoro-
- 3-(1,2-Dihydro-2-oxo-4-pyridinyl)-2-fluorobenzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.