CAS 1261908-30-8

4′-Methyl 3′-fluoro-5-(trifluoromethyl)[1,1′-biphenyl]-3,4′-dicarboxylate

Description:

4′-Methyl 3′-fluoro-5-(trifluoromethyl)[1,1′-biphenyl]-3,4′-dicarboxylate is a complex organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features multiple functional groups, including methyl, fluoro, and trifluoromethyl substituents, which significantly influence its chemical properties and reactivity. The presence of dicarboxylate groups indicates that it can participate in various chemical reactions, such as esterification or amidation. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and influencing the compound's biological activity. Additionally, the fluorine atoms can enhance the stability and solubility of the compound in organic solvents. Overall, this substance may exhibit interesting characteristics in terms of its reactivity, solubility, and potential applications in pharmaceuticals or agrochemicals, although specific behavior would depend on the context of use and environmental conditions.

Formula: C₁₆H₁₀F₄O₄

InChI: InChI=1S/C16H10F4O4/c1-24-15(23)12-3-2-8(7-13(12)17)9-4-10(14(21)22)6-11(5-9)16(18,19)20/h2-7H,1H3,(H,21,22)

InChI key: InChIKey=MGQMGMWHBCZFJX-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=C(C(O)=O)C1)C2=CC(F)=C(C(OC)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-3,4′-dicarboxylic acid, 3′-fluoro-5-(trifluoromethyl)-, 4′-methyl ester
• 4′-Methyl 3′-fluoro-5-(trifluoromethyl)[1,1′-biphenyl]-3,4′-dicarboxylate