
CAS 1261908-32-0
:5-Chloro-2′-methyl[1,1′-biphenyl]-3-ol
Description:
5-Chloro-2′-methyl[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the 5-position and a methyl group at the 2′-position of the biphenyl framework contributes to its unique chemical properties. The hydroxyl (-OH) group at the 3-position enhances its polarity and solubility in polar solvents, making it a potential candidate for various applications in organic synthesis and pharmaceuticals. This compound may exhibit biological activity due to its structural features, which can influence interactions with biological targets. Additionally, the chlorine substituent can affect the compound's reactivity and stability, making it relevant in the study of chlorinated organic compounds. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require experimental determination or reference to detailed chemical databases for precise values. Overall, 5-Chloro-2′-methyl[1,1′-biphenyl]-3-ol represents a class of compounds that are of interest in both industrial and research settings.
Formula:C13H11ClO
InChI:InChI=1S/C13H11ClO/c1-9-4-2-3-5-13(9)10-6-11(14)8-12(15)7-10/h2-8,15H,1H3
InChI key:InChIKey=XZCAHMDJWLNUMI-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1)C2=CC(Cl)=CC(O)=C2
Synonyms:- [1,1′-Biphenyl]-3-ol, 5-chloro-2′-methyl-
- 5-Chloro-2′-methyl[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
