CymitQuimica logo

CAS 1261908-33-1

:

2-[4-Fluoro-3-(trifluoromethyl)phenyl]-4-pyridinecarboxylic acid

Description:
2-[4-Fluoro-3-(trifluoromethyl)phenyl]-4-pyridinecarboxylic acid, identified by its CAS number 1261908-33-1, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with both a fluorine atom and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential acidity due to the carboxylic acid functional group. The presence of multiple fluorine atoms enhances its lipophilicity and may influence its reactivity and interaction with biological systems. Such fluorinated compounds are often studied for their applications in pharmaceuticals and agrochemicals due to their unique electronic properties and stability. Additionally, the specific arrangement of substituents can affect the compound's solubility, boiling point, and melting point, making it of interest in various chemical and industrial applications. Overall, this compound represents a significant example of fluorinated heterocycles in modern chemistry.
Formula:C13H7F4NO2
InChI:InChI=1S/C13H7F4NO2/c14-10-2-1-7(5-9(10)13(15,16)17)11-6-8(12(19)20)3-4-18-11/h1-6H,(H,19,20)
InChI key:InChIKey=HDTPFXFOXULATL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1F)C2=CC(C(O)=O)=CC=N2
Synonyms:
  • 2-[4-Fluoro-3-(trifluoromethyl)phenyl]-4-pyridinecarboxylic acid
  • 4-Pyridinecarboxylic acid, 2-[4-fluoro-3-(trifluoromethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.