
CAS 1261908-41-1
:5-Chloro-5′-fluoro[1,1′-biphenyl]-3,3′-diol
Description:
5-Chloro-5′-fluoro[1,1′-biphenyl]-3,3′-diol is an organic compound characterized by the presence of a biphenyl structure with specific halogen and hydroxyl substitutions. The compound features a chlorine atom at the 5-position and a fluorine atom at the 5′-position of the biphenyl moiety, along with hydroxyl groups at the 3 and 3′ positions. This substitution pattern contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The presence of both halogen atoms and hydroxyl groups can influence the compound's polarity, making it more soluble in polar solvents. Additionally, the compound may exhibit interesting biological activities due to its structural features, which could be relevant in medicinal chemistry. Its CAS number, 1261908-41-1, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and materials science. Overall, the compound's distinct functional groups and biphenyl framework make it a subject of interest for further study in organic chemistry.
Formula:C12H8ClFO2
InChI:InChI=1S/C12H8ClFO2/c13-9-1-7(3-11(15)5-9)8-2-10(14)6-12(16)4-8/h1-6,15-16H
InChI key:InChIKey=ICMZSEUKGQHUII-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=C(O)C1)C2=CC(F)=CC(O)=C2
Synonyms:- [1,1′-Biphenyl]-3,3′-diol, 5-chloro-5′-fluoro-
- 5-Chloro-5′-fluoro[1,1′-biphenyl]-3,3′-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.