CAS 1261908-42-2

2-Chloro-5-[4-fluoro-3-(trifluoromethyl)phenyl]-3-pyridinecarboxylic acid

Description:

2-Chloro-5-[4-fluoro-3-(trifluoromethyl)phenyl]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple halogen substituents. The presence of a chloro group and a trifluoromethyl group contributes to its unique reactivity and potential applications in pharmaceuticals and agrochemicals. This compound is likely to exhibit polar characteristics due to the electronegative halogens, influencing its solubility and interaction with biological systems. The carboxylic acid functional group suggests acidity, which can play a role in its reactivity and interactions with other molecules. Additionally, the fluorine atoms can enhance the compound's metabolic stability and lipophilicity, making it a candidate for various chemical syntheses and biological studies. Overall, the structural features of 2-Chloro-5-[4-fluoro-3-(trifluoromethyl)phenyl]-3-pyridinecarboxylic acid indicate its potential utility in medicinal chemistry and material science, although specific applications would depend on further research and development.

Formula: C₁₃H₆ClF₄NO₂

InChI: InChI=1S/C13H6ClF4NO2/c14-11-8(12(20)21)3-7(5-19-11)6-1-2-10(15)9(4-6)13(16,17)18/h1-5H,(H,20,21)

InChI key: InChIKey=XUAZMIRPTMPJBL-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=CC1F)C=2C=C(C(O)=O)C(Cl)=NC2

Synonyms:

• 2-Chloro-5-[4-fluoro-3-(trifluoromethyl)phenyl]-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 2-chloro-5-[4-fluoro-3-(trifluoromethyl)phenyl]-