
CAS 1261908-51-3
:5-[4-(1-Pyrrolidinylsulfonyl)phenyl]-3-pyridinecarboxylic acid
Description:
5-[4-(1-Pyrrolidinylsulfonyl)phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261908-51-3, is a chemical compound that features a pyridine ring substituted with a carboxylic acid group and a phenyl group linked to a pyrrolidinylsulfonyl moiety. This structure suggests potential biological activity, particularly in medicinal chemistry, where such compounds may exhibit properties relevant to drug development. The presence of the pyrrolidinyl group may enhance solubility and bioavailability, while the sulfonyl group can contribute to the compound's reactivity and interaction with biological targets. The carboxylic acid functionality is likely to influence the compound's acidity and ability to form salts, which can be important for pharmacokinetics. Overall, this compound's unique structural features may make it a candidate for further investigation in therapeutic applications, particularly in areas such as anti-inflammatory or analgesic research. However, specific data on its physical properties, biological activity, and safety profile would require further empirical studies.
Formula:C16H16N2O4S
InChI:InChI=1S/C16H16N2O4S/c19-16(20)14-9-13(10-17-11-14)12-3-5-15(6-4-12)23(21,22)18-7-1-2-8-18/h3-6,9-11H,1-2,7-8H2,(H,19,20)
InChI key:InChIKey=MVQDXANUUUIFOZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1)C2=CC=C(S(=O)(=O)N3CCCC3)C=C2
Synonyms:- 5-[4-(1-Pyrrolidinylsulfonyl)phenyl]-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 5-[4-(1-pyrrolidinylsulfonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.