
CAS 1261908-56-8
:5-(3-Chloro-5-methylphenyl)-3-pyridinol
Description:
5-(3-Chloro-5-methylphenyl)-3-pyridinol is an organic compound characterized by its pyridine and phenyl functional groups. The presence of a pyridinol moiety indicates that it contains a hydroxyl group (-OH) attached to the pyridine ring, which contributes to its potential as a weak base. The chloromethylphenyl group introduces a chlorine atom and a methyl group on the phenyl ring, influencing the compound's reactivity and solubility. This structure suggests that the compound may exhibit biological activity, potentially interacting with various biological targets due to the presence of both the aromatic and heterocyclic components. Its molecular properties, such as melting point, boiling point, and solubility, would depend on the specific arrangement of atoms and the presence of functional groups. Additionally, the compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features. Safety and handling considerations would be necessary, given the presence of chlorine, which can pose health risks.
Formula:C12H10ClNO
InChI:InChI=1S/C12H10ClNO/c1-8-2-9(4-11(13)3-8)10-5-12(15)7-14-6-10/h2-7,15H,1H3
InChI key:InChIKey=XANYVXGZDPFFAU-UHFFFAOYSA-N
SMILES:CC=1C=C(C=C(Cl)C1)C=2C=C(O)C=NC2
Synonyms:- 5-(3-Chloro-5-methylphenyl)-3-pyridinol
- 3-Pyridinol, 5-(3-chloro-5-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.