CymitQuimica logo

CAS 1261908-87-5

:

Benzoic acid, 3-methoxy-5-(2-thienyl)-

Description:
Benzoic acid, 3-methoxy-5-(2-thienyl)-, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a methoxy group and a thienyl group. The presence of the methoxy group (-OCH3) at the 3-position enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The thienyl group, derived from thiophene, introduces sulfur into the structure, which can affect the compound's electronic properties and potential biological activity. This compound is likely to exhibit typical benzoic acid characteristics, such as acidity due to the carboxylic acid functional group, and may participate in hydrogen bonding. Its unique substituents may also impart specific properties, such as altered melting and boiling points, as well as potential applications in pharmaceuticals or agrochemicals. Overall, the combination of these functional groups suggests that this compound could have interesting chemical behavior and potential utility in various fields of research.
Formula:C12H10O3S
InChI:InChI=1S/C12H10O3S/c1-15-10-6-8(11-3-2-4-16-11)5-9(7-10)12(13)14/h2-7H,1H3,(H,13,14)
InChI key:InChIKey=VCURJHSMKRELTO-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(OC)C1)C2=CC=CS2
Synonyms:
  • Benzoic acid, 3-methoxy-5-(2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.