CAS 1261908-89-7

2-Hydroxy-3′-(trifluoromethoxy)[1,1′-biphenyl]-4-carboxylic acid

Description:

2-Hydroxy-3′-(trifluoromethoxy)[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) and a carboxylic acid group (-COOH) contributes to its acidic properties, making it a potential candidate for various chemical reactions, including esterification and amidation. The trifluoromethoxy group (-O-CF3) enhances its lipophilicity and may influence its biological activity, potentially making it useful in pharmaceutical applications. This compound is likely to exhibit moderate to high stability under standard conditions, although its reactivity can be influenced by the functional groups present. Additionally, the trifluoromethoxy substituent can affect the compound's electronic properties, potentially impacting its interactions with biological targets. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.

Formula: C₁₄H₉F₃O₄

InChI: InChI=1S/C14H9F3O4/c15-14(16,17)21-10-3-1-2-8(6-10)11-5-4-9(13(19)20)7-12(11)18/h1-7,18H,(H,19,20)

InChI key: InChIKey=ICJXANULUPMIAO-UHFFFAOYSA-N

SMILES: OC1=C(C=CC(C(O)=O)=C1)C2=CC(OC(F)(F)F)=CC=C2

Synonyms:

• 2-Hydroxy-3′-(trifluoromethoxy)[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 2-hydroxy-3′-(trifluoromethoxy)-

3-Hydroxy-4-(3-trifluoromethoxyphenyl)benzoic acid

Controlled Product

CAS: 1261908-89-7

Please enquire for more information about 3-Hydroxy-4-(3-trifluoromethoxyphenyl)benzoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₉F₃O₄

Purity: Min. 95%

Molecular weight: 298.21 g/mol

Ref: 3D-LAC90889