CymitQuimica logo

CAS 1261909-19-6

:

3′-Amino-4-chloro[1,1′-biphenyl]-3-carboxylic acid

Description:
3′-Amino-4-chloro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an amino group (-NH2) and a carboxylic acid group (-COOH) contributes to its functionality, making it a potential candidate for various chemical reactions and applications in pharmaceuticals or agrochemicals. The chlorine substituent at the 4-position of the biphenyl enhances its reactivity and may influence its biological activity. This compound is likely to exhibit polar characteristics due to the amino and carboxylic acid groups, which can engage in hydrogen bonding. Its molecular structure suggests that it may have applications in medicinal chemistry, particularly in the development of compounds with specific biological activities. Additionally, the presence of halogen atoms can affect the compound's solubility and stability, making it an interesting subject for further research in synthetic organic chemistry.
Formula:C13H10ClNO2
InChI:InChI=1S/C13H10ClNO2/c14-12-5-4-9(7-11(12)13(16)17)8-2-1-3-10(15)6-8/h1-7H,15H2,(H,16,17)
InChI key:InChIKey=NXTIWIPPBNNPSA-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1Cl)C2=CC(N)=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 3′-amino-4-chloro-
  • 3′-Amino-4-chloro[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.