CymitQuimica logo

CAS 1261909-34-5

:

2-(5-Formyl-2-thienyl)-5-methoxybenzoic acid

Description:
2-(5-Formyl-2-thienyl)-5-methoxybenzoic acid is an organic compound characterized by its complex structure, which includes a thienyl group, a formyl group, and a methoxybenzoic acid moiety. This compound features a thienyl ring, which contributes to its aromatic properties and potential reactivity. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation or reduction, making it versatile in synthetic applications. The methoxy group enhances its solubility in organic solvents and may influence its electronic properties. As a benzoic acid derivative, it exhibits acidic characteristics, allowing it to form salts and esters. The compound's unique structure may also impart specific biological activities, making it of interest in pharmaceutical research. Overall, 2-(5-Formyl-2-thienyl)-5-methoxybenzoic acid is a compound with potential applications in organic synthesis and medicinal chemistry, owing to its functional groups and structural features.
Formula:C13H10O4S
InChI:InChI=1S/C13H10O4S/c1-17-8-2-4-10(11(6-8)13(15)16)12-5-3-9(7-14)18-12/h2-7H,1H3,(H,15,16)
InChI key:InChIKey=YWYDZMZPMXLXOM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC(OC)=C1)C=2SC(C=O)=CC2
Synonyms:
  • Benzoic acid, 2-(5-formyl-2-thienyl)-5-methoxy-
  • 2-(5-Formyl-2-thienyl)-5-methoxybenzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.