CAS 1261909-50-5

4-Chloro-4′-hydroxy-3′-nitro[1,1′-biphenyl]-3-carboxylic acid

Description:

4-Chloro-4′-hydroxy-3′-nitro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features several functional groups, including a carboxylic acid (-COOH), a nitro group (-NO2), a hydroxyl group (-OH), and a chlorine atom (Cl) attached to the biphenyl framework. The presence of these groups contributes to its potential reactivity and solubility in various solvents. The nitro group typically imparts electron-withdrawing properties, influencing the compound's acidity and reactivity in electrophilic substitution reactions. The chlorine atom and hydroxyl group can also participate in hydrogen bonding, affecting the compound's physical properties, such as melting point and solubility. This compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and development. Safety and handling precautions should be observed due to the presence of potentially hazardous functional groups.

Formula: C₁₃H₈ClNO₅

InChI: InChI=1S/C13H8ClNO5/c14-10-3-1-7(5-9(10)13(17)18)8-2-4-12(16)11(6-8)15(19)20/h1-6,16H,(H,17,18)

InChI key: InChIKey=AGXXOUMOFFMTJF-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=CC1Cl)C2=CC(N(=O)=O)=C(O)C=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 4-chloro-4′-hydroxy-3′-nitro-
• 4-Chloro-4′-hydroxy-3′-nitro[1,1′-biphenyl]-3-carboxylic acid