CymitQuimica logo

CAS 1261909-68-5

:

2′-Methoxy-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol

Description:
2′-Methoxy-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH3) at the 2' position and a trifluoromethyl group (-CF3) at the 5 position significantly influences its chemical properties, including its polarity and reactivity. The hydroxyl group (-OH) at the 3 position contributes to its potential as a phenolic compound, which can participate in hydrogen bonding and exhibit antioxidant properties. This compound is likely to be lipophilic due to the biphenyl framework and the trifluoromethyl group, which can enhance its stability and resistance to metabolic degradation. Its unique combination of functional groups may also impart specific biological activities, making it of interest in pharmaceutical and agrochemical research. Overall, 2′-Methoxy-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol represents a versatile structure with potential applications in various fields of chemistry.
Formula:C14H11F3O2
InChI:InChI=1S/C14H11F3O2/c1-19-13-5-3-2-4-12(13)9-6-10(14(15,16)17)8-11(18)7-9/h2-8,18H,1H3
InChI key:InChIKey=HSBUWWMHPGEXFL-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)C2=CC(C(F)(F)F)=CC(O)=C2
Synonyms:
  • [1,1′-Biphenyl]-3-ol, 2′-methoxy-5-(trifluoromethyl)-
  • 2′-Methoxy-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.