CymitQuimica logo

CAS 1261909-99-2

:

3′,5′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxylic acid

Description:
3′,5′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 3' and 5' positions of the biphenyl moiety contributes to its unique chemical properties, including increased lipophilicity and potential for specific interactions in biological systems. The hydroxyl group at the 3 position and the carboxylic acid group at the 4 position enhance its polarity and solubility in polar solvents, making it suitable for various applications in pharmaceuticals and agrochemicals. This compound may exhibit interesting biological activities due to its structural features, which can influence its interaction with biological targets. Additionally, the presence of fluorine atoms often enhances metabolic stability and bioavailability. Overall, 3′,5′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxylic acid represents a versatile chemical entity with potential utility in medicinal chemistry and related fields.
Formula:C13H8F2O3
InChI:InChI=1S/C13H8F2O3/c14-9-3-8(4-10(15)6-9)7-1-2-11(13(17)18)12(16)5-7/h1-6,16H,(H,17,18)
InChI key:InChIKey=RVBBOQPVZGIGTM-UHFFFAOYSA-N
SMILES:OC=1C=C(C=CC1C(O)=O)C2=CC(F)=CC(F)=C2
Synonyms:
  • [1,1′-Biphenyl]-4-carboxylic acid, 3′,5′-difluoro-3-hydroxy-
  • 3′,5′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.