CAS 1261910-07-9

4′-Acetyl-5-chloro[1,1′-biphenyl]-2-carboxylic acid

Description:

4′-Acetyl-5-chloro[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an acetyl group at the para position and a carboxylic acid group at the ortho position relative to the chlorine substituent contributes to its chemical reactivity and potential applications. The chlorine atom introduces electronegativity, influencing the compound's polarity and solubility in various solvents. This compound may exhibit biological activity due to its structural features, making it of interest in pharmaceutical research. Additionally, the carboxylic acid functional group can participate in hydrogen bonding, affecting its interactions in biological systems. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of its structure. Overall, 4′-Acetyl-5-chloro[1,1′-biphenyl]-2-carboxylic acid represents a versatile molecule with potential applications in medicinal chemistry and materials science.

Formula: C₁₅H₁₁ClO₃

InChI: InChI=1S/C15H11ClO3/c1-9(17)10-2-4-11(5-3-10)14-8-12(16)6-7-13(14)15(18)19/h2-8H,1H3,(H,18,19)

InChI key: InChIKey=MGFKJFFYLUHWGE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=C(Cl)C=C1)C2=CC=C(C(C)=O)C=C2

Synonyms:

• 4′-Acetyl-5-chloro[1,1′-biphenyl]-2-carboxylic acid
• [1,1′-Biphenyl]-2-carboxylic acid, 4′-acetyl-5-chloro-