CAS 1261910-70-6

4-[2-Fluoro-3-(trifluoromethyl)phenyl]-3-pyridinecarboxylic acid

Description:

4-[2-Fluoro-3-(trifluoromethyl)phenyl]-3-pyridinecarboxylic acid, with the CAS number 1261910-70-6, is a chemical compound characterized by its complex aromatic structure. It features a pyridine ring substituted with a carboxylic acid group and a phenyl ring that contains both a fluorine atom and a trifluoromethyl group. This compound is likely to exhibit significant polarity due to the presence of the carboxylic acid functional group, which can participate in hydrogen bonding. The trifluoromethyl group contributes to its lipophilicity and can influence its reactivity and interaction with biological systems. Additionally, the fluorine substituents can enhance the compound's stability and alter its electronic properties, making it of interest in medicinal chemistry and material science. The presence of multiple fluorine atoms may also affect the compound's solubility and volatility. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, where fluorinated compounds are often sought for their enhanced biological activity and metabolic stability.

Formula: C₁₃H₇F₄NO₂

InChI: InChI=1S/C13H7F4NO2/c14-11-8(2-1-3-10(11)13(15,16)17)7-4-5-18-6-9(7)12(19)20/h1-6H,(H,19,20)

InChI key: InChIKey=PMCOXHKGXZUWSE-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CC=NC1)C2=C(F)C(C(F)(F)F)=CC=C2

Synonyms:

• 4-[2-Fluoro-3-(trifluoromethyl)phenyl]-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 4-[2-fluoro-3-(trifluoromethyl)phenyl]-