
CAS 1261910-75-1
:2-Amino-5-(3-carboxy-5-fluorophenyl)-4-pyridinecarboxylic acid
Description:
2-Amino-5-(3-carboxy-5-fluorophenyl)-4-pyridinecarboxylic acid, identified by its CAS number 1261910-75-1, is a chemical compound that features a pyridine ring substituted with both amino and carboxylic acid functional groups, as well as a fluorinated phenyl group. This compound is characterized by its potential biological activity, particularly in medicinal chemistry, where it may serve as a lead compound for drug development. The presence of the amino group contributes to its basicity, while the carboxylic acid groups impart acidic properties, allowing for various interactions in biological systems. The fluorine atom enhances lipophilicity and can influence the compound's pharmacokinetic properties. Additionally, the structural arrangement suggests potential for hydrogen bonding and other intermolecular interactions, which are critical in determining the compound's solubility and reactivity. Overall, this compound's unique structure positions it as a candidate for further research in therapeutic applications, particularly in areas targeting specific biological pathways.
Formula:C13H9FN2O4
InChI:InChI=1S/C13H9FN2O4/c14-8-2-6(1-7(3-8)12(17)18)10-5-16-11(15)4-9(10)13(19)20/h1-5H,(H2,15,16)(H,17,18)(H,19,20)
InChI key:InChIKey=GYCAMQOSYBFZSI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C2=CC(C(O)=O)=CC(F)=C2)=CN=C(N)C1
Synonyms:- 2-Amino-5-(3-carboxy-5-fluorophenyl)-4-pyridinecarboxylic acid
- 4-Pyridinecarboxylic acid, 2-amino-5-(3-carboxy-5-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.