CAS 1261911-08-3

5-(2-Chloro-5-methoxyphenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid

Description:

5-(2-Chloro-5-methoxyphenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid, with the CAS number 1261911-08-3, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. This compound features a chloro and methoxy substituent on a phenyl ring, contributing to its unique chemical properties and potential biological activity. The presence of the dihydro and keto groups indicates that it may exhibit specific reactivity patterns, such as participating in hydrogen bonding or acting as a potential ligand in coordination chemistry. Its molecular structure suggests that it could be of interest in medicinal chemistry, possibly exhibiting pharmacological properties. The compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it a candidate for further research in various chemical and biological applications. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.

Formula: C₁₃H₁₀ClNO₄

InChI: InChI=1S/C13H10ClNO4/c1-19-7-2-3-11(14)8(4-7)10-6-15-12(16)5-9(10)13(17)18/h2-6H,1H3,(H,15,16)(H,17,18)

InChI key: InChIKey=YKGNJBGOJPSGQT-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CNC(=O)C1)C2=CC(OC)=CC=C2Cl

Synonyms:

• 4-Pyridinecarboxylic acid, 5-(2-chloro-5-methoxyphenyl)-1,2-dihydro-2-oxo-
• 5-(2-Chloro-5-methoxyphenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid